C14H15N3O2S2 — CID 62047463
1-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]-1,4-diazepan-5-one (PubChem CID 62047463) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62047463 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 1-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)Cc2csc(-c3ccsc3)n2)CCN1 |
| InChI | InChI=1S/C14H15N3O2S2/c18-12-1-4-17(5-3-15-12)13(19)7-11-9-21-14(16-11)10-2-6-20-8-10/h2,6,8-9H,1,3-5,7H2,(H,15,18) |
| InChIKey | BNFFGDVQBKONSZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |