C14H15N3O3S — CID 62045731
1-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-1,4-diazepan-5-one (PubChem CID 62045731) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62045731 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 1-[2-[2-(furan-2-yl)-1,3-thiazol-4-yl]acetyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)Cc2csc(-c3ccco3)n2)CCN1 |
| InChI | InChI=1S/C14H15N3O3S/c18-12-3-5-17(6-4-15-12)13(19)8-10-9-21-14(16-10)11-2-1-7-20-11/h1-2,7,9H,3-6,8H2,(H,15,18) |
| InChIKey | XPNFZXSIASCLPL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |