C12H14N6O3 — CID 62045729
1-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]-1,4-diazepan-5-one (PubChem CID 62045729) has the molecular formula C12H14N6O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]-1,4-diazepan-5-one.
| Compound Name | 1-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62045729 |
| Molecular Formula | C12H14N6O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C(=O)Cn2nnc(-c3ccco3)n2)CCN1 |
| InChI | InChI=1S/C12H14N6O3/c19-10-3-5-17(6-4-13-10)11(20)8-18-15-12(14-16-18)9-2-1-7-21-9/h1-2,7H,3-6,8H2,(H,13,19) |
| InChIKey | XUQRXGOQVJISOP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |