C17H20N4O4S2 — CID 36664417
N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)acetamide (PubChem CID 36664417) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)acetamide.
| Compound Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 36664417 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(thiophen-2-ylsulfonylamino)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1cccs1)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C17H20N4O4S2/c22-15(11-20-27(24,25)17-2-1-9-26-17)19-10-13-3-5-14(6-4-13)21-8-7-18-16(23)12-21/h1-6,9,20H,7-8,10-12H2,(H,18,23)(H,19,22) |
| InChIKey | HFALQHGFWWPRBI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|