C20H19Cl2N3O2 — CID 46461930
(E)-3-(2,6-dichlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]prop-2-enamide (PubChem CID 46461930) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46461930 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(Cl)cccc1Cl)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c21-17-2-1-3-18(22)16(17)8-9-19(26)24-12-14-4-6-15(7-5-14)25-11-10-23-20(27)13-25/h1-9H,10-13H2,(H,23,27)(H,24,26)/b9-8+ |
| InChIKey | ZUXNRLSSOFIRBO-CMDGGOBGSA-N |
| XLogP | 3.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|