C19H18Cl3N3O3 — CID 46443063
N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 46443063) has the molecular formula C19H18Cl3N3O3 and a molecular weight of 442.73 g/mol. Its IUPAC name is N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 46443063 |
| Molecular Formula | C19H18Cl3N3O3 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NCc1ccc(N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C19H18Cl3N3O3/c20-14-7-16(22)17(8-15(14)21)28-11-19(27)24-9-12-1-3-13(4-2-12)25-6-5-23-18(26)10-25/h1-4,7-8H,5-6,9-11H2,(H,23,26)(H,24,27) |
| InChIKey | MDHQFKIIPAPAFI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|