C19H20Cl2N2O2S — CID 55854945
2-(2,5-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]acetamide (PubChem CID 55854945) has the molecular formula C19H20Cl2N2O2S and a molecular weight of 411.35 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 55854945 |
| Molecular Formula | C19H20Cl2N2O2S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]acetamide |
| SMILES | O=C(COc1cc(Cl)ccc1Cl)NCc1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C19H20Cl2N2O2S/c20-15-3-6-17(21)18(11-15)25-13-19(24)22-12-14-1-4-16(5-2-14)23-7-9-26-10-8-23/h1-6,11H,7-10,12-13H2,(H,22,24) |
| InChIKey | MGXKWZQZJQQZFR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|