C20H24Cl2N2O2 — CID 46665376
2-(2,5-dichlorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide (PubChem CID 46665376) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 2-(2,5-dichlorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2,5-dichlorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 46665376 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-(2,5-dichlorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H24Cl2N2O2/c1-3-24(4-2)13-16-7-5-15(6-8-16)12-23-20(25)14-26-19-11-17(21)9-10-18(19)22/h5-11H,3-4,12-14H2,1-2H3,(H,23,25) |
| InChIKey | OZHRSECQHLQLRX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |