C20H24BrFN2O2 — CID 8948095
2-(2-bromo-4-fluorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide (PubChem CID 8948095) has the molecular formula C20H24BrFN2O2 and a molecular weight of 423.33 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(2-bromo-4-fluorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 8948095 |
| Molecular Formula | C20H24BrFN2O2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-(2-bromo-4-fluorophenoxy)-N-[[4-(diethylaminomethyl)phenyl]methyl]acetamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)COc2ccc(F)cc2Br)cc1 |
| InChI | InChI=1S/C20H24BrFN2O2/c1-3-24(4-2)13-16-7-5-15(6-8-16)12-23-20(25)14-26-19-10-9-17(22)11-18(19)21/h5-11H,3-4,12-14H2,1-2H3,(H,23,25) |
| InChIKey | BRYUSDJTWMSXAO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |