C21H24Cl2N2O3 — CID 16890044
2-(2,4-dichlorophenoxy)-N-[3-(4-morpholin-4-ylphenyl)propyl]acetamide (PubChem CID 16890044) has the molecular formula C21H24Cl2N2O3 and a molecular weight of 423.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[3-(4-morpholin-4-ylphenyl)propyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[3-(4-morpholin-4-ylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 16890044 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[3-(4-morpholin-4-ylphenyl)propyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O3/c22-17-5-8-20(19(23)14-17)28-15-21(26)24-9-1-2-16-3-6-18(7-4-16)25-10-12-27-13-11-25/h3-8,14H,1-2,9-13,15H2,(H,24,26) |
| InChIKey | GVJJGOQVFWZUSK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|