C20H22Cl2N2O2S — CID 60521599
2-(2,4-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]propanamide (PubChem CID 60521599) has the molecular formula C20H22Cl2N2O2S and a molecular weight of 425.38 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 60521599 |
| Molecular Formula | C20H22Cl2N2O2S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(4-thiomorpholin-4-ylphenyl)methyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NCc1ccc(N2CCSCC2)cc1 |
| InChI | InChI=1S/C20H22Cl2N2O2S/c1-14(26-19-7-4-16(21)12-18(19)22)20(25)23-13-15-2-5-17(6-3-15)24-8-10-27-11-9-24/h2-7,12,14H,8-11,13H2,1H3,(H,23,25) |
| InChIKey | OIZXZDZHAURHKO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|