C16H15Cl2NO4 — CID 70843494
2-(2,4-dichlorophenoxy)-N-[(3,4-dihydroxyphenyl)methyl]propanamide (PubChem CID 70843494) has the molecular formula C16H15Cl2NO4 and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(3,4-dihydroxyphenyl)methyl]propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-dihydroxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 70843494 |
| Molecular Formula | C16H15Cl2NO4 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(3,4-dihydroxyphenyl)methyl]propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H15Cl2NO4/c1-9(23-15-5-3-11(17)7-12(15)18)16(22)19-8-10-2-4-13(20)14(21)6-10/h2-7,9,20-21H,8H2,1H3,(H,19,22) |
| InChIKey | JYNRPLILTVAFLG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|