C25H29N5O5 — CID 55681411
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide (PubChem CID 55681411) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 55681411 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]butanamide |
| SMILES | COc1cc2ncn(CCCC(=O)NCc3ccc(N4CCNC(=O)C4)cc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C25H29N5O5/c1-34-21-12-19-20(13-22(21)35-2)28-16-30(25(19)33)10-3-4-23(31)27-14-17-5-7-18(8-6-17)29-11-9-26-24(32)15-29/h5-8,12-13,16H,3-4,9-11,14-15H2,1-2H3,(H,26,32)(H,27,31) |
| InChIKey | STASBIBYQPEHAS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|