C20H28N2O2 — CID 84582403
1-[2-[(5-methoxy-2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 84582403) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[2-[(5-methoxy-2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-[(5-methoxy-2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 84582403 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[2-[(5-methoxy-2-methyl-1H-indol-3-yl)methyl]pyrrolidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1ccc2[nH]c(C)c(CC3CCCN3C(=O)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C20H28N2O2/c1-13-16(17-12-15(24-5)8-9-18(17)21-13)11-14-7-6-10-22(14)19(23)20(2,3)4/h8-9,12,14,21H,6-7,10-11H2,1-5H3 |
| InChIKey | AXZPRDBJYGIAMY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|