C15H19FN2 — CID 178091795
5-fluoro-2-methyl-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 178091795) has the molecular formula C15H19FN2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-fluoro-2-methyl-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 5-fluoro-2-methyl-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 178091795 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-fluoro-2-methyl-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | [2H]C([2H])([2H])N1CCC[C@@H]1Cc1c(C)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C15H19FN2/c1-10-13(9-12-4-3-7-18(12)2)14-8-11(16)5-6-15(14)17-10/h5-6,8,12,17H,3-4,7,9H2,1-2H3/t12-/m1/s1/i2D3 |
| InChIKey | KDQYJDNASARTIV-IBIJPGRPSA-N |
| XLogP | 3.25 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|