C20H28N2O — CID 178091739
2-cyclopentyl-5-methoxy-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole (PubChem CID 178091739) has the molecular formula C20H28N2O and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-cyclopentyl-5-methoxy-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole.
| Compound Name | 2-cyclopentyl-5-methoxy-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
|---|---|
| PubChem CID | 178091739 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 2-cyclopentyl-5-methoxy-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
| SMILES | [2H]C([2H])([2H])N1CCC[C@@H]1Cc1c(C2CCCC2)[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C20H28N2O/c1-22-11-5-8-15(22)12-18-17-13-16(23-2)9-10-19(17)21-20(18)14-6-3-4-7-14/h9-10,13-15,21H,3-8,11-12H2,1-2H3/t15-/m1/s1/i1D3 |
| InChIKey | JBPGCCCNQDMRHY-DDOHFVCQSA-N |
| XLogP | 4.47 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |