C18H22N2O — CID 177142000
acetylene;7-methoxy-16-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene (PubChem CID 177142000) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is acetylene;7-methoxy-16-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene.
| Compound Name | acetylene;7-methoxy-16-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 177142000 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | acetylene;7-methoxy-16-methyl-3,12-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
| SMILES | C#C.COc1ccc2[nH]c3c(c2c1)CN1CCCC3C1C |
| InChI | InChI=1S/C16H20N2O.C2H2/c1-10-12-4-3-7-18(10)9-14-13-8-11(19-2)5-6-15(13)17-16(12)14;1-2/h5-6,8,10,12,17H,3-4,7,9H2,1-2H3;1-2H |
| InChIKey | FMJJIYMBKZPTFN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|