C21H22N2O2 — CID 137467201
(1R)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene (PubChem CID 137467201) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (1R)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene.
| Compound Name | (1R)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene |
|---|---|
| PubChem CID | 137467201 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (1R)-6,19-dimethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaene |
| SMILES | COc1ccc2c(c1)[C@H]1Cc3c([nH]c4ccc(OC)cc34)CN1CC2 |
| InChI | InChI=1S/C21H22N2O2/c1-24-14-4-3-13-7-8-23-12-20-18(11-21(23)16(13)9-14)17-10-15(25-2)5-6-19(17)22-20/h3-6,9-10,21-22H,7-8,11-12H2,1-2H3/t21-/m1/s1 |
| InChIKey | DQPMUUAOTWRFRE-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|