C29H27F3N2O3 — CID 131978869
6,19-dimethoxy-18-[[4-(trifluoromethyl)phenyl]methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 131978869) has the molecular formula C29H27F3N2O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is 6,19-dimethoxy-18-[[4-(trifluoromethyl)phenyl]methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | 6,19-dimethoxy-18-[[4-(trifluoromethyl)phenyl]methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 131978869 |
| Molecular Formula | C29H27F3N2O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 6,19-dimethoxy-18-[[4-(trifluoromethyl)phenyl]methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1c2cc(OC)c(OCc4ccc(C(F)(F)F)cc4)cc2CCN1C3 |
| InChI | InChI=1S/C29H27F3N2O3/c1-35-20-7-8-24-22(12-20)23-13-26-21-14-27(36-2)28(11-18(21)9-10-34(26)15-25(23)33-24)37-16-17-3-5-19(6-4-17)29(30,31)32/h3-8,11-12,14,26,33H,9-10,13,15-16H2,1-2H3 |
| InChIKey | QICGTYJZLJRYKI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|