C23H23F3N2O2 — CID 141353714
(1S)-6,18-dimethoxy-19-(2,2,2-trifluoroethyl)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 141353714) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is (1S)-6,18-dimethoxy-19-(2,2,2-trifluoroethyl)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | (1S)-6,18-dimethoxy-19-(2,2,2-trifluoroethyl)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 141353714 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (1S)-6,18-dimethoxy-19-(2,2,2-trifluoroethyl)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)C[C@H]1c2cc(CC(F)(F)F)c(OC)cc2CCN1C3 |
| InChI | InChI=1S/C23H23F3N2O2/c1-29-15-3-4-19-17(9-15)18-10-21-16-7-14(11-23(24,25)26)22(30-2)8-13(16)5-6-28(21)12-20(18)27-19/h3-4,7-9,21,27H,5-6,10-12H2,1-2H3/t21-/m0/s1 |
| InChIKey | SSMTYPNWYFTIMQ-NRFANRHFSA-N |
| XLogP | 4.95 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|