C22H22N2O3 — CID 141353725
(11S)-20-methoxy-11-methyl-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene (PubChem CID 141353725) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (11S)-20-methoxy-11-methyl-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene.
| Compound Name | (11S)-20-methoxy-11-methyl-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
|---|---|
| PubChem CID | 141353725 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (11S)-20-methoxy-11-methyl-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CC1c2cc4c(cc2[C@H](C)CN1C3)OCO4 |
| InChI | InChI=1S/C22H22N2O3/c1-12-9-24-10-19-16(15-5-13(25-2)3-4-18(15)23-19)6-20(24)17-8-22-21(7-14(12)17)26-11-27-22/h3-5,7-8,12,20,23H,6,9-11H2,1-2H3/t12-,20?/m1/s1 |
| InChIKey | ZTRHQAQKYYQJJI-ZRIYNBNISA-N |
| XLogP | 4.12 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|