C20H17FN2O2 — CID 134137522
19-fluoro-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene (PubChem CID 134137522) has the molecular formula C20H17FN2O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is 19-fluoro-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene.
| Compound Name | 19-fluoro-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
|---|---|
| PubChem CID | 134137522 |
| Molecular Formula | C20H17FN2O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 19-fluoro-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaene |
| SMILES | Fc1ccc2c3c([nH]c2c1)CN1CCc2cc4c(cc2C1C3)OCO4 |
| InChI | InChI=1S/C20H17FN2O2/c21-12-1-2-13-15-7-18-14-8-20-19(24-10-25-20)5-11(14)3-4-23(18)9-17(15)22-16(13)6-12/h1-2,5-6,8,18,22H,3-4,7,9-10H2 |
| InChIKey | NLRFTUGWWMRTOZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|