C23H26N2O4 — CID 159524158
methane;(20-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaen-16-yl)methanol (PubChem CID 159524158) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methane;(20-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaen-16-yl)methanol.
| Compound Name | methane;(20-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaen-16-yl)methanol |
|---|---|
| PubChem CID | 159524158 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methane;(20-methoxy-5,7-dioxa-13,16-diazahexacyclo[11.11.0.02,10.04,8.015,23.017,22]tetracosa-2,4(8),9,15(23),17(22),18,20-heptaen-16-yl)methanol |
| SMILES | C.COc1ccc2c(c1)c1c(n2CO)CN2CCc3cc4c(cc3C2C1)OCO4 |
| InChI | InChI=1S/C22H22N2O4.CH4/c1-26-14-2-3-18-16(7-14)17-8-19-15-9-22-21(27-12-28-22)6-13(15)4-5-23(19)10-20(17)24(18)11-25;/h2-3,6-7,9,19,25H,4-5,8,10-12H2,1H3;1H4 |
| InChIKey | MCEHXFWVILSQAY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|