C36H33FN2O5 — CID 131978563
(6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methyl 4-fluorobenzoate (PubChem CID 131978563) has the molecular formula C36H33FN2O5 and a molecular weight of 592.67 g/mol. Its IUPAC name is (6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methyl 4-fluorobenzoate.
| Compound Name | (6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 131978563 |
| Molecular Formula | C36H33FN2O5 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | (6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl)methyl 4-fluorobenzoate |
| SMILES | COc1ccc2c(c1)c1c(n2COC(=O)c2ccc(F)cc2)CN2CCc3cc(OC)c(OCc4ccccc4)cc3C2C1 |
| InChI | InChI=1S/C36H33FN2O5/c1-41-27-12-13-31-29(17-27)30-18-32-28-19-35(43-21-23-6-4-3-5-7-23)34(42-2)16-25(28)14-15-38(32)20-33(30)39(31)22-44-36(40)24-8-10-26(37)11-9-24/h3-13,16-17,19,32H,14-15,18,20-22H2,1-2H3 |
| InChIKey | UHYXZWVAUHXTDP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 62.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|