C30H32N2O5 — CID 131978577
[6,18-dimethoxy-19-[(2-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol (PubChem CID 131978577) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is [6,18-dimethoxy-19-[(2-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol.
| Compound Name | [6,18-dimethoxy-19-[(2-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 131978577 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | [6,18-dimethoxy-19-[(2-methoxyphenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
| SMILES | COc1ccc2c(c1)c1c(n2CO)CN2CCc3cc(OC)c(OCc4ccccc4OC)cc3C2C1 |
| InChI | InChI=1S/C30H32N2O5/c1-34-21-8-9-25-23(13-21)24-14-26-22-15-30(37-17-20-6-4-5-7-28(20)35-2)29(36-3)12-19(22)10-11-31(26)16-27(24)32(25)18-33/h4-9,12-13,15,26,33H,10-11,14,16-18H2,1-3H3 |
| InChIKey | OOLFGPLNGRUDKG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|