C23H26N2O4 — CID 137467058
[6-methoxy-19-(methoxymethoxy)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaen-10-yl]methanol (PubChem CID 137467058) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [6-methoxy-19-(methoxymethoxy)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaen-10-yl]methanol.
| Compound Name | [6-methoxy-19-(methoxymethoxy)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 137467058 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [6-methoxy-19-(methoxymethoxy)-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16(21),17,19-heptaen-10-yl]methanol |
| SMILES | COCOc1ccc2c(c1)C1Cc3c(n(CO)c4ccc(OC)cc34)CN1CC2 |
| InChI | InChI=1S/C23H26N2O4/c1-27-14-29-17-4-3-15-7-8-24-12-23-20(11-22(24)18(15)10-17)19-9-16(28-2)5-6-21(19)25(23)13-26/h3-6,9-10,22,26H,7-8,11-14H2,1-2H3 |
| InChIKey | IZEROXLVBDZUSE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|