C35H33FN2O4S — CID 145375381
10-[(4-fluorophenyl)sulfanyloxymethyl]-6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 145375381) has the molecular formula C35H33FN2O4S and a molecular weight of 596.72 g/mol. Its IUPAC name is 10-[(4-fluorophenyl)sulfanyloxymethyl]-6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | 10-[(4-fluorophenyl)sulfanyloxymethyl]-6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 145375381 |
| Molecular Formula | C35H33FN2O4S |
| Molecular Weight | 596.72 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 10-[(4-fluorophenyl)sulfanyloxymethyl]-6,18-dimethoxy-19-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1ccc2c(c1)c1c(n2COSc2ccc(F)cc2)CN2CCc3cc(OC)c(OCc4ccccc4)cc3C2C1 |
| InChI | InChI=1S/C35H33FN2O4S/c1-39-26-10-13-31-29(17-26)30-18-32-28-19-35(41-21-23-6-4-3-5-7-23)34(40-2)16-24(28)14-15-37(32)20-33(30)38(31)22-42-43-27-11-8-25(36)9-12-27/h3-13,16-17,19,32H,14-15,18,20-22H2,1-2H3 |
| InChIKey | KQAOCCHVRYUIRM-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 45.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|