C29H31BrN2O3 — CID 159900866
[19-[(4-bromophenyl)methoxy]-18-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol;methane (PubChem CID 159900866) has the molecular formula C29H31BrN2O3 and a molecular weight of 535.48 g/mol. Its IUPAC name is [19-[(4-bromophenyl)methoxy]-18-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol;methane.
| Compound Name | [19-[(4-bromophenyl)methoxy]-18-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol;methane |
|---|---|
| PubChem CID | 159900866 |
| Molecular Formula | C29H31BrN2O3 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | [19-[(4-bromophenyl)methoxy]-18-methoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4,6,8,16,18,20-heptaen-10-yl]methanol;methane |
| SMILES | C.COc1cc2c(cc1OCc1ccc(Br)cc1)C1Cc3c(n(CO)c4ccccc34)CN1CC2 |
| InChI | InChI=1S/C28H27BrN2O3.CH4/c1-33-27-12-19-10-11-30-15-26-23(21-4-2-3-5-24(21)31(26)17-32)13-25(30)22(19)14-28(27)34-16-18-6-8-20(29)9-7-18;/h2-9,12,14,25,32H,10-11,13,15-17H2,1H3;1H4 |
| InChIKey | NVXZVRCKKWYMBZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|