C29H27F3N2O4 — CID 131978528
[6,19-dimethoxy-18-[(3,4,5-trifluorophenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol (PubChem CID 131978528) has the molecular formula C29H27F3N2O4 and a molecular weight of 524.54 g/mol. Its IUPAC name is [6,19-dimethoxy-18-[(3,4,5-trifluorophenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol.
| Compound Name | [6,19-dimethoxy-18-[(3,4,5-trifluorophenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
|---|---|
| PubChem CID | 131978528 |
| Molecular Formula | C29H27F3N2O4 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | [6,19-dimethoxy-18-[(3,4,5-trifluorophenyl)methoxy]-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaen-10-yl]methanol |
| SMILES | COc1ccc2c(c1)c1c(n2CO)CN2CCc3cc(OCc4cc(F)c(F)c(F)c4)c(OC)cc3C2C1 |
| InChI | InChI=1S/C29H27F3N2O4/c1-36-18-3-4-24-20(10-18)21-11-25-19-12-27(37-2)28(38-14-16-7-22(30)29(32)23(31)8-16)9-17(19)5-6-33(25)13-26(21)34(24)15-35/h3-4,7-10,12,25,35H,5-6,11,13-15H2,1-2H3 |
| InChIKey | GLVIXAMTPJQKQT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 56.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|