C34H32N2O5S — CID 131978706
10-(benzenesulfonyl)-6,19-dimethoxy-18-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene (PubChem CID 131978706) has the molecular formula C34H32N2O5S and a molecular weight of 580.71 g/mol. Its IUPAC name is 10-(benzenesulfonyl)-6,19-dimethoxy-18-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene.
| Compound Name | 10-(benzenesulfonyl)-6,19-dimethoxy-18-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
|---|---|
| PubChem CID | 131978706 |
| Molecular Formula | C34H32N2O5S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | 10-(benzenesulfonyl)-6,19-dimethoxy-18-phenylmethoxy-10,13-diazapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-3(11),4(9),5,7,16,18,20-heptaene |
| SMILES | COc1ccc2c(c1)c1c(n2S(=O)(=O)c2ccccc2)CN2CCc3cc(OCc4ccccc4)c(OC)cc3C2C1 |
| InChI | InChI=1S/C34H32N2O5S/c1-39-25-13-14-30-28(18-25)29-19-31-27-20-33(40-2)34(41-22-23-9-5-3-6-10-23)17-24(27)15-16-35(31)21-32(29)36(30)42(37,38)26-11-7-4-8-12-26/h3-14,17-18,20,31H,15-16,19,21-22H2,1-2H3 |
| InChIKey | PJWPKDHCMOWQFL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |