C33H30ClNO5 — CID 68952336
(12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) benzoate (PubChem CID 68952336) has the molecular formula C33H30ClNO5 and a molecular weight of 556.06 g/mol. Its IUPAC name is (12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) benzoate.
| Compound Name | (12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) benzoate |
|---|---|
| PubChem CID | 68952336 |
| Molecular Formula | C33H30ClNO5 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | (12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) benzoate |
| SMILES | COc1cc2c(cc1OCc1ccccc1)C1Cc3c(Cl)cc(OC)c(OC(=O)c4ccccc4)c3CN1CC2 |
| InChI | InChI=1S/C33H30ClNO5/c1-37-29-15-23-13-14-35-19-26-25(16-28(35)24(23)17-30(29)39-20-21-9-5-3-6-10-21)27(34)18-31(38-2)32(26)40-33(36)22-11-7-4-8-12-22/h3-12,15,17-18,28H,13-14,16,19-20H2,1-2H3 |
| InChIKey | LWXDRWAMURTLQW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|