C33H37ClN2O7 — CID 68953277
(12-chloro-2-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 68953277) has the molecular formula C33H37ClN2O7 and a molecular weight of 609.12 g/mol. Its IUPAC name is (12-chloro-2-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | (12-chloro-2-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 68953277 |
| Molecular Formula | C33H37ClN2O7 |
| Molecular Weight | 609.12 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | (12-chloro-2-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | COc1cc2c(cc1O)C1Cc3c(Cl)cc(OC)c(OC(=O)C(Cc4ccccc4)NC(=O)OC(C)(C)C)c3CN1CC2 |
| InChI | InChI=1S/C33H37ClN2O7/c1-33(2,3)43-32(39)35-25(13-19-9-7-6-8-10-19)31(38)42-30-23-18-36-12-11-20-14-28(40-4)27(37)16-21(20)26(36)15-22(23)24(34)17-29(30)41-5/h6-10,14,16-17,25-26,37H,11-13,15,18H2,1-5H3,(H,35,39) |
| InChIKey | KACWFLIOTARQCI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.12 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|