C32H38ClNO7 — CID 68953027
2-[2-[2-[(12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl)oxy]ethoxy]ethoxy]ethanol (PubChem CID 68953027) has the molecular formula C32H38ClNO7 and a molecular weight of 584.11 g/mol. Its IUPAC name is 2-[2-[2-[(12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl)oxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[(12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl)oxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 68953027 |
| Molecular Formula | C32H38ClNO7 |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 2-[2-[2-[(12-chloro-3,10-dimethoxy-2-phenylmethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl)oxy]ethoxy]ethoxy]ethanol |
| SMILES | COc1cc2c(cc1OCc1ccccc1)C1Cc3c(Cl)cc(OC)c(OCCOCCOCCO)c3CN1CC2 |
| InChI | InChI=1S/C32H38ClNO7/c1-36-29-16-23-8-9-34-20-26-25(17-28(34)24(23)18-30(29)41-21-22-6-4-3-5-7-22)27(33)19-31(37-2)32(26)40-15-14-39-13-12-38-11-10-35/h3-7,16,18-19,28,35H,8-15,17,20-21H2,1-2H3 |
| InChIKey | PURBFZAFTUPMNZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|