C37H32ClNO6 — CID 68948969
[12-chloro-3,10-dimethoxy-9-[(E)-3-phenylprop-2-enoyl]oxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 68948969) has the molecular formula C37H32ClNO6 and a molecular weight of 622.12 g/mol. Its IUPAC name is [12-chloro-3,10-dimethoxy-9-[(E)-3-phenylprop-2-enoyl]oxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [12-chloro-3,10-dimethoxy-9-[(E)-3-phenylprop-2-enoyl]oxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 68948969 |
| Molecular Formula | C37H32ClNO6 |
| Molecular Weight | 622.12 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | [12-chloro-3,10-dimethoxy-9-[(E)-3-phenylprop-2-enoyl]oxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc2c(cc1OC(=O)/C=C/c1ccccc1)C1Cc3c(Cl)cc(OC)c(OC(=O)/C=C/c4ccccc4)c3CN1CC2 |
| InChI | InChI=1S/C37H32ClNO6/c1-42-32-19-26-17-18-39-23-29-28(20-31(39)27(26)21-33(32)44-35(40)15-13-24-9-5-3-6-10-24)30(38)22-34(43-2)37(29)45-36(41)16-14-25-11-7-4-8-12-25/h3-16,19,21-22,31H,17-18,20,23H2,1-2H3/b15-13+,16-14+ |
| InChIKey | XAPXTVUNYARKTM-WXUKJITCSA-N |
| XLogP | 7.25 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.12 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|