C27H33NO5 — CID 164619697
(2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) cyclohexanecarboxylate (PubChem CID 164619697) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) cyclohexanecarboxylate.
| Compound Name | (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 164619697 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) cyclohexanecarboxylate |
| SMILES | COc1cc2c(cc1OC)C1Cc3ccc(OC)c(OC(=O)C4CCCCC4)c3CN1CC2 |
| InChI | InChI=1S/C27H33NO5/c1-30-23-10-9-18-13-22-20-15-25(32-3)24(31-2)14-19(20)11-12-28(22)16-21(18)26(23)33-27(29)17-7-5-4-6-8-17/h9-10,14-15,17,22H,4-8,11-13,16H2,1-3H3 |
| InChIKey | LVMZRZSFUOMGRQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|