C31H37NO5 — CID 164619337
(2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) adamantane-1-carboxylate (PubChem CID 164619337) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) adamantane-1-carboxylate.
| Compound Name | (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 164619337 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | (2,3,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-9-yl) adamantane-1-carboxylate |
| SMILES | COc1cc2c(cc1OC)C1Cc3ccc(OC)c(OC(=O)C45CC6CC(CC(C6)C4)C5)c3CN1CC2 |
| InChI | InChI=1S/C31H37NO5/c1-34-26-5-4-21-11-25-23-13-28(36-3)27(35-2)12-22(23)6-7-32(25)17-24(21)29(26)37-30(33)31-14-18-8-19(15-31)10-20(9-18)16-31/h4-5,12-13,18-20,25H,6-11,14-17H2,1-3H3 |
| InChIKey | AERVYUNAHQEIGU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|