C29H39N3O6 — CID 68953622
[2-(2-amino-3-methylbutanoyl)oxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl] 2-amino-3-methylbutanoate (PubChem CID 68953622) has the molecular formula C29H39N3O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is [2-(2-amino-3-methylbutanoyl)oxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl] 2-amino-3-methylbutanoate.
| Compound Name | [2-(2-amino-3-methylbutanoyl)oxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 68953622 |
| Molecular Formula | C29H39N3O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | [2-(2-amino-3-methylbutanoyl)oxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-10-yl] 2-amino-3-methylbutanoate |
| SMILES | COc1cc2c(cc1OC(=O)C(N)C(C)C)C1Cc3ccc(OC(=O)C(N)C(C)C)c(OC)c3CN1CC2 |
| InChI | InChI=1S/C29H39N3O6/c1-15(2)25(30)28(33)37-22-8-7-17-11-21-19-13-24(38-29(34)26(31)16(3)4)23(35-5)12-18(19)9-10-32(21)14-20(17)27(22)36-6/h7-8,12-13,15-16,21,25-26H,9-11,14,30-31H2,1-6H3 |
| InChIKey | BDJXEPVUZFYUHR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|