C21H23NO7 — CID 143896073
(10-hydroxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl)oxy methyl carbonate (PubChem CID 143896073) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is (10-hydroxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl)oxy methyl carbonate.
| Compound Name | (10-hydroxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl)oxy methyl carbonate |
|---|---|
| PubChem CID | 143896073 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (10-hydroxy-3,9-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl)oxy methyl carbonate |
| SMILES | COC(=O)OOc1cc2c(cc1OC)CCN1Cc3c(ccc(O)c3OC)CC21 |
| InChI | InChI=1S/C21H23NO7/c1-25-18-9-13-6-7-22-11-15-12(4-5-17(23)20(15)26-2)8-16(22)14(13)10-19(18)28-29-21(24)27-3/h4-5,9-10,16,23H,6-8,11H2,1-3H3 |
| InChIKey | YIQOFHPHLNKVKL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|