C19H21CaNO3 — CID 145497002
calcium;carbanide;9-methoxy-3,5,6,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-3-ide-2,10-diol (PubChem CID 145497002) has the molecular formula C19H21CaNO3 and a molecular weight of 351.46 g/mol. Its IUPAC name is calcium;carbanide;9-methoxy-3,5,6,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-3-ide-2,10-diol.
| Compound Name | calcium;carbanide;9-methoxy-3,5,6,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-3-ide-2,10-diol |
|---|---|
| PubChem CID | 145497002 |
| Molecular Formula | C19H21CaNO3 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | calcium;carbanide;9-methoxy-3,5,6,8,13,13a-hexahydroisoquinolino[2,1-b]isoquinolin-3-ide-2,10-diol |
| SMILES | COc1c(O)ccc2c1CN1CCc3c[c-]c(O)cc3C1C2.[CH3-].[Ca+2] |
| InChI | InChI=1S/C18H18NO3.CH3.Ca/c1-22-18-15-10-19-7-6-11-2-4-13(20)9-14(11)16(19)8-12(15)3-5-17(18)21;;/h2-3,5,9,16,20-21H,6-8,10H2,1H3;1H3;/q2*-1;+2 |
| InChIKey | ZOXJGLWUNSGMAK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|