C19H21NO4 — CID 78011274
9,12-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,3-diol (PubChem CID 78011274) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is 9,12-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,3-diol.
| Compound Name | 9,12-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,3-diol |
|---|---|
| PubChem CID | 78011274 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 9,12-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,3-diol |
| SMILES | COc1ccc(OC)c2c1CC1c3cc(O)c(O)cc3CCN1C2 |
| InChI | InChI=1S/C19H21NO4/c1-23-18-3-4-19(24-2)14-10-20-6-5-11-7-16(21)17(22)9-12(11)15(20)8-13(14)18/h3-4,7,9,15,21-22H,5-6,8,10H2,1-2H3 |
| InChIKey | QNEFEUWSOPMZJT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|