C21H23NO3 — CID 71109798
(1S)-16,19-dimethoxy-5-oxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene (PubChem CID 71109798) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (1S)-16,19-dimethoxy-5-oxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene.
| Compound Name | (1S)-16,19-dimethoxy-5-oxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene |
|---|---|
| PubChem CID | 71109798 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (1S)-16,19-dimethoxy-5-oxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene |
| SMILES | COc1ccc(OC)c2c1C[C@H]1c3cc4c(cc3CCN1C2)CCO4 |
| InChI | InChI=1S/C21H23NO3/c1-23-19-3-4-20(24-2)17-12-22-7-5-13-9-14-6-8-25-21(14)11-15(13)18(22)10-16(17)19/h3-4,9,11,18H,5-8,10,12H2,1-2H3/t18-/m0/s1 |
| InChIKey | LTFQFOFBBKSKEW-SFHVURJKSA-N |
| XLogP | 3.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |