C27H25NO6 — CID 89454353
(17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 4-methoxybenzoate (PubChem CID 89454353) has the molecular formula C27H25NO6 and a molecular weight of 459.50 g/mol. Its IUPAC name is (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 4-methoxybenzoate.
| Compound Name | (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 4-methoxybenzoate |
|---|---|
| PubChem CID | 89454353 |
| Molecular Formula | C27H25NO6 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2c(OC)ccc3c2CN2CCc4cc5c(cc4C2C3)OOC5)cc1 |
| InChI | InChI=1S/C27H25NO6/c1-30-20-6-3-16(4-7-20)27(29)33-26-22-14-28-10-9-18-11-19-15-32-34-25(19)13-21(18)23(28)12-17(22)5-8-24(26)31-2/h3-8,11,13,23H,9-10,12,14-15H2,1-2H3 |
| InChIKey | BWJIRMISNNKKOL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|