C29H29NO8 — CID 89454417
(17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 3,4,5-trimethoxybenzoate (PubChem CID 89454417) has the molecular formula C29H29NO8 and a molecular weight of 519.55 g/mol. Its IUPAC name is (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 3,4,5-trimethoxybenzoate.
| Compound Name | (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 89454417 |
| Molecular Formula | C29H29NO8 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (17-methoxy-5,6-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2c(OC)ccc3c2CN2CCc4cc5c(cc4C2C3)OOC5)cc(OC)c1OC |
| InChI | InChI=1S/C29H29NO8/c1-32-23-6-5-16-10-22-20-13-24-19(15-36-38-24)9-17(20)7-8-30(22)14-21(16)27(23)37-29(31)18-11-25(33-2)28(35-4)26(12-18)34-3/h5-6,9,11-13,22H,7-8,10,14-15H2,1-4H3 |
| InChIKey | BMBOQCLDJXCGBL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|