C27H25F3N2O6 — CID 156719378
(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) N-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]carbamate (PubChem CID 156719378) has the molecular formula C27H25F3N2O6 and a molecular weight of 530.50 g/mol. Its IUPAC name is (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) N-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]carbamate.
| Compound Name | (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) N-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]carbamate |
|---|---|
| PubChem CID | 156719378 |
| Molecular Formula | C27H25F3N2O6 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl) N-[(3Z)-5-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]carbamate |
| SMILES | C=C(/C=C\C(=C)OC(F)(F)F)NC(=O)Oc1c(OC)ccc2c1CN1CCc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C27H25F3N2O6/c1-15(4-5-16(2)38-27(28,29)30)31-26(33)37-25-20-13-32-9-8-18-11-23-24(36-14-35-23)12-19(18)21(32)10-17(20)6-7-22(25)34-3/h4-7,11-12,21H,1-2,8-10,13-14H2,3H3,(H,31,33)/b5-4- |
| InChIKey | MHTIZHAJKHMFFK-PLNGDYQASA-N |
| XLogP | 5.29 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|