C25H25N3O4 — CID 46834581
6-[(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl)oxy]-5-methylpyridin-3-amine (PubChem CID 46834581) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 6-[(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl)oxy]-5-methylpyridin-3-amine.
| Compound Name | 6-[(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl)oxy]-5-methylpyridin-3-amine |
|---|---|
| PubChem CID | 46834581 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 6-[(17-methoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaen-16-yl)oxy]-5-methylpyridin-3-amine |
| SMILES | COc1ccc2c(c1Oc1ncc(N)cc1C)CN1CCc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C25H25N3O4/c1-14-7-17(26)11-27-25(14)32-24-19-12-28-6-5-16-9-22-23(31-13-30-22)10-18(16)20(28)8-15(19)3-4-21(24)29-2/h3-4,7,9-11,20H,5-6,8,12-13,26H2,1-2H3 |
| InChIKey | CDAWAXVRYPWTPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |