C21H23NO4 — CID 11279643
(1S,14R)-16,17-dimethoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene (PubChem CID 11279643) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (1S,14R)-16,17-dimethoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene.
| Compound Name | (1S,14R)-16,17-dimethoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
|---|---|
| PubChem CID | 11279643 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (1S,14R)-16,17-dimethoxy-14-methyl-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| SMILES | COc1ccc2c(c1OC)[C@@H](C)N1CCc3cc4c(cc3[C@@H]1C2)OCO4 |
| InChI | InChI=1S/C21H23NO4/c1-12-20-14(4-5-17(23-2)21(20)24-3)8-16-15-10-19-18(25-11-26-19)9-13(15)6-7-22(12)16/h4-5,9-10,12,16H,6-8,11H2,1-3H3/t12-,16+/m1/s1 |
| InChIKey | AASYYPUSFKCGBB-WBMJQRKESA-N |
| XLogP | 3.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |