C19H21NO3 — CID 639024
(8R,13aS)-3-methoxy-8-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,9-diol (PubChem CID 639024) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (8R,13aS)-3-methoxy-8-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,9-diol.
| Compound Name | (8R,13aS)-3-methoxy-8-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,9-diol |
|---|---|
| PubChem CID | 639024 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (8R,13aS)-3-methoxy-8-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline-2,9-diol |
| SMILES | COc1cc2c(cc1O)[C@@H]1Cc3cccc(O)c3[C@@H](C)N1CC2 |
| InChI | InChI=1S/C19H21NO3/c1-11-19-13(4-3-5-16(19)21)8-15-14-10-17(22)18(23-2)9-12(14)6-7-20(11)15/h3-5,9-11,15,21-22H,6-8H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | KORRMVPBTCIUPT-ABAIWWIYSA-N |
| XLogP | 3.32 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|