C20H21NO6 — CID 44606418
2,10-dihydroxy-3,9,11-trimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 44606418) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2,10-dihydroxy-3,9,11-trimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | 2,10-dihydroxy-3,9,11-trimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 44606418 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2,10-dihydroxy-3,9,11-trimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | COc1cc2c(cc1O)C1Cc3cc(OC)c(O)c(OC)c3C(=O)N1CC2 |
| InChI | InChI=1S/C20H21NO6/c1-25-15-7-10-4-5-21-13(12(10)9-14(15)22)6-11-8-16(26-2)18(23)19(27-3)17(11)20(21)24/h7-9,13,22-23H,4-6H2,1-3H3 |
| InChIKey | VJKLBWMPXONGIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |