C21H23NO4 — CID 71110289
16,17-dimethoxy-2-methyl-6,8-dioxa-1-azapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-3,5(9),10,14,16,18-hexaene (PubChem CID 71110289) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 16,17-dimethoxy-2-methyl-6,8-dioxa-1-azapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-3,5(9),10,14,16,18-hexaene.
| Compound Name | 16,17-dimethoxy-2-methyl-6,8-dioxa-1-azapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-3,5(9),10,14,16,18-hexaene |
|---|---|
| PubChem CID | 71110289 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 16,17-dimethoxy-2-methyl-6,8-dioxa-1-azapentacyclo[11.8.0.03,11.05,9.014,19]henicosa-3,5(9),10,14,16,18-hexaene |
| SMILES | COc1cc2c(cc1OC)C1Cc3cc4c(cc3C(C)N1CC2)OCO4 |
| InChI | InChI=1S/C21H23NO4/c1-12-15-9-21-20(25-11-26-21)8-14(15)6-17-16-10-19(24-3)18(23-2)7-13(16)4-5-22(12)17/h7-10,12,17H,4-6,11H2,1-3H3 |
| InChIKey | KWLLUULEVUUQQH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |