C21H21NO6 — CID 155533758
17,18-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-12-carboxylic acid (PubChem CID 155533758) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is 17,18-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-12-carboxylic acid.
| Compound Name | 17,18-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-12-carboxylic acid |
|---|---|
| PubChem CID | 155533758 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 17,18-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15,17,19-hexaene-12-carboxylic acid |
| SMILES | COc1cc2c(cc1OC)CN1C(C(=O)O)Cc3cc4c(cc3C1C2)OCO4 |
| InChI | InChI=1S/C21H21NO6/c1-25-17-5-11-3-15-14-8-20-19(27-10-28-20)6-12(14)4-16(21(23)24)22(15)9-13(11)7-18(17)26-2/h5-8,15-16H,3-4,9-10H2,1-2H3,(H,23,24) |
| InChIKey | VIZBTLYHJHIQTH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |